Products Description
| CAS: | 5415-44-1 |
| Melting point | ≥300 °C |
| Boiling point | 349.7°C (rough estimate) |
| density | 1.3649 (rough estimate) |
| refractive index | 1.6590 (estimate) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 5.85±0.70(Predicted) |
| color | White to Pale Beige |
| Water Solubility | 24mg/L(room temperature) |
| InChI | InChI=1S/C8H10N4O3/c1-10-4-5(9-7(10)14)11(2)8(15)12(3)6(4)13/h1-3H3,(H,9,14) |
| InChIKey | BYXCFUMGEBZDDI-UHFFFAOYSA-N |
| SMILES | N1(C)C2=C(N(C)C(=O)N(C)C2=O)NC1=O |
| Uses | 1,3,7-Trimethyluric Acid is a caffeine derivative, and a methyl derivative of uric acid. Detected as a urine marker of caffeine consumption. |
| Definition | ChEBI: An oxopurine in which the purine ring is substituted by oxo groups at positions 2, 6, and 8, and the nitrogens at positions 1, 3, and 7 are substituted by methyl groups. It is a metabolite of caffeine. |
| Purification Methods | Crystallise it from water and dry it at 100o in a vacuum. It has UV: 289nm (pH 2.5). [Beilstein 26 III/IV 2623.] |
| 1,3,7-TRIMETHYLURIC ACID Preparation Products And Raw materials |
